About (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate
(2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate (PubChem CID 624014) has the molecular formula C15H10Br2N2O7
and a molecular weight of 490.06 g/mol. Its IUPAC name is (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate |
| PubChem CID | 624014 |
| Molecular Formula | C15H10Br2N2O7 |
| Molecular Weight | 490.06 g/mol |
| Exact Mass | 487.89 |
| IUPAC Name | (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate |
| SMILES | O=C(CCc1cc(Br)c(O)c(Br)c1)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10Br2N2O7/c16-10-5-8(6-11(17)15(10)21)1-4-14(20)26-13-3-2-9(18(22)23)7-12(13)19(24)25/h2-3,5-7,21H,1,4H2 |
| InChIKey | IJSXWJBHIMTLMZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.06 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate?
The IUPAC name of (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate (CID 624014) is (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate.
What is the SMILES notation for (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate?
The canonical SMILES for (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate is O=C(CCc1cc(Br)c(O)c(Br)c1)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate?
The InChIKey is IJSXWJBHIMTLMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Br2N2O7/c16-10-5-8(6-11(17)15(10)21)1-4-14(20)26-13-3-2-9(18(22)23)7-12(13)19(24)25/h2-3,5-7,21H,1,4H2.
What are the key properties of (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate?
(2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate has a molecular weight of 490.06 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl) 3-(3,5-dibromo-4-hydroxyphenyl)propanoate is sourced from PubChem (CID 624014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).