About (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate
(2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate (PubChem CID 137365173) has the molecular formula C18H11FN2O8
and a molecular weight of 402.29 g/mol. Its IUPAC name is (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate |
| PubChem CID | 137365173 |
| Molecular Formula | C18H11FN2O8 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate |
| SMILES | O=C(CCc1coc2cc(F)ccc2c1=O)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H11FN2O8/c19-11-2-4-13-16(7-11)28-9-10(18(13)23)1-6-17(22)29-15-5-3-12(20(24)25)8-14(15)21(26)27/h2-5,7-9H,1,6H2 |
| InChIKey | XYSRSMNAQPJWRU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 142.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate?
The IUPAC name of (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate (CID 137365173) is (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate.
What is the SMILES notation for (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate?
The canonical SMILES for (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate is O=C(CCc1coc2cc(F)ccc2c1=O)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate?
The InChIKey is XYSRSMNAQPJWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11FN2O8/c19-11-2-4-13-16(7-11)28-9-10(18(13)23)1-6-17(22)29-15-5-3-12(20(24)25)8-14(15)21(26)27/h2-5,7-9H,1,6H2.
What are the key properties of (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate?
(2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate has a molecular weight of 402.29 g/mol, XLogP of 3.29, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl) 3-(7-fluoro-4-oxochromen-3-yl)propanoate is sourced from PubChem (CID 137365173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).