C23H19Br2N5O11 — CID 155099151
2-butan-2-yl-4,6-dinitrophenol;2,6-dibromo-4-[(E)-(2,4-dinitrophenoxy)iminomethyl]phenol (PubChem CID 155099151) has the molecular formula C23H19Br2N5O11 and a molecular weight of 701.24 g/mol. Its IUPAC name is 2-butan-2-yl-4,6-dinitrophenol;2,6-dibromo-4-[(E)-(2,4-dinitrophenoxy)iminomethyl]phenol.
| Compound Name | 2-butan-2-yl-4,6-dinitrophenol;2,6-dibromo-4-[(E)-(2,4-dinitrophenoxy)iminomethyl]phenol |
|---|---|
| PubChem CID | 155099151 |
| Molecular Formula | C23H19Br2N5O11 |
| Molecular Weight | 701.24 g/mol |
| Exact Mass | 698.94 |
| IUPAC Name | 2-butan-2-yl-4,6-dinitrophenol;2,6-dibromo-4-[(E)-(2,4-dinitrophenoxy)iminomethyl]phenol |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.O=[N+]([O-])c1ccc(O/N=C/c2cc(Br)c(O)c(Br)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7Br2N3O6.C10H12N2O5/c14-9-3-7(4-10(15)13(9)19)6-16-24-12-2-1-8(17(20)21)5-11(12)18(22)23;1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h1-6,19H;4-6,13H,3H2,1-2H3/b16-6+; |
| InChIKey | WXIOIITWBZBHKG-FPUQOWELSA-N |
| XLogP | 6.87 |
| TPSA | 234.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.24 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|