C17H11Br2N3O5 — CID 173459772
[2,6-dibromo-4-[(2-cyano-4-nitrophenoxy)iminomethyl]phenyl] propanoate (PubChem CID 173459772) has the molecular formula C17H11Br2N3O5 and a molecular weight of 497.10 g/mol. Its IUPAC name is [2,6-dibromo-4-[(2-cyano-4-nitrophenoxy)iminomethyl]phenyl] propanoate.
| Compound Name | [2,6-dibromo-4-[(2-cyano-4-nitrophenoxy)iminomethyl]phenyl] propanoate |
|---|---|
| PubChem CID | 173459772 |
| Molecular Formula | C17H11Br2N3O5 |
| Molecular Weight | 497.10 g/mol |
| Exact Mass | 494.91 |
| IUPAC Name | [2,6-dibromo-4-[(2-cyano-4-nitrophenoxy)iminomethyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Br)cc(C=NOc2ccc([N+](=O)[O-])cc2C#N)cc1Br |
| InChI | InChI=1S/C17H11Br2N3O5/c1-2-16(23)26-17-13(18)5-10(6-14(17)19)9-21-27-15-4-3-12(22(24)25)7-11(15)8-20/h3-7,9H,2H2,1H3 |
| InChIKey | ZOMOVXOLKMMRRQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 114.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.10 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|