C11H9Br2NO4 — CID 3987245
[2,4-dibromo-6-(2-nitroethenyl)phenyl] propanoate (PubChem CID 3987245) has the molecular formula C11H9Br2NO4 and a molecular weight of 379.00 g/mol. Its IUPAC name is [2,4-dibromo-6-(2-nitroethenyl)phenyl] propanoate.
| Compound Name | [2,4-dibromo-6-(2-nitroethenyl)phenyl] propanoate |
|---|---|
| PubChem CID | 3987245 |
| Molecular Formula | C11H9Br2NO4 |
| Molecular Weight | 379.00 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | [2,4-dibromo-6-(2-nitroethenyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Br)cc(Br)cc1C=C[N+](=O)[O-] |
| InChI | InChI=1S/C11H9Br2NO4/c1-2-10(15)18-11-7(3-4-14(16)17)5-8(12)6-9(11)13/h3-6H,2H2,1H3 |
| InChIKey | STZCAWWSEFIFMU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.00 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|