C15H12Br2N2O5 — CID 91189876
[4-(4-amino-3-nitrophenoxy)-3,5-dibromophenyl] propanoate (PubChem CID 91189876) has the molecular formula C15H12Br2N2O5 and a molecular weight of 460.08 g/mol. Its IUPAC name is [4-(4-amino-3-nitrophenoxy)-3,5-dibromophenyl] propanoate.
| Compound Name | [4-(4-amino-3-nitrophenoxy)-3,5-dibromophenyl] propanoate |
|---|---|
| PubChem CID | 91189876 |
| Molecular Formula | C15H12Br2N2O5 |
| Molecular Weight | 460.08 g/mol |
| Exact Mass | 457.91 |
| IUPAC Name | [4-(4-amino-3-nitrophenoxy)-3,5-dibromophenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(Br)c(Oc2ccc(N)c([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2N2O5/c1-2-14(20)23-9-5-10(16)15(11(17)6-9)24-8-3-4-12(18)13(7-8)19(21)22/h3-7H,2,18H2,1H3 |
| InChIKey | AOGFAWWHAICXCQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.08 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|