C20H20Br2N2O7 — CID 90755901
methyl 2-[3,5-dibromo-4-[4-(2,2-dimethylpropanoylamino)-3-nitrophenoxy]phenoxy]acetate (PubChem CID 90755901) has the molecular formula C20H20Br2N2O7 and a molecular weight of 560.20 g/mol. Its IUPAC name is methyl 2-[3,5-dibromo-4-[4-(2,2-dimethylpropanoylamino)-3-nitrophenoxy]phenoxy]acetate.
| Compound Name | methyl 2-[3,5-dibromo-4-[4-(2,2-dimethylpropanoylamino)-3-nitrophenoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 90755901 |
| Molecular Formula | C20H20Br2N2O7 |
| Molecular Weight | 560.20 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | methyl 2-[3,5-dibromo-4-[4-(2,2-dimethylpropanoylamino)-3-nitrophenoxy]phenoxy]acetate |
| SMILES | COC(=O)COc1cc(Br)c(Oc2ccc(NC(=O)C(C)(C)C)c([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C20H20Br2N2O7/c1-20(2,3)19(26)23-15-6-5-11(9-16(15)24(27)28)31-18-13(21)7-12(8-14(18)22)30-10-17(25)29-4/h5-9H,10H2,1-4H3,(H,23,26) |
| InChIKey | UNVNTWIZRPHSBO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.20 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|