C14H7F5N2O4 — CID 3094461
N-[2-nitro-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]acetamide (PubChem CID 3094461) has the molecular formula C14H7F5N2O4 and a molecular weight of 362.21 g/mol. Its IUPAC name is N-[2-nitro-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]acetamide.
| Compound Name | N-[2-nitro-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 3094461 |
| Molecular Formula | C14H7F5N2O4 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-[2-nitro-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2c(F)c(F)c(F)c(F)c2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7F5N2O4/c1-5(22)20-7-3-2-6(4-8(7)21(23)24)25-14-12(18)10(16)9(15)11(17)13(14)19/h2-4H,1H3,(H,20,22) |
| InChIKey | YXSJREZTZNJYJB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|