C19H18Cl2N2O6 — CID 91558705
[3,5-dichloro-4-[4-(2-methylpropanoylamino)-3-nitrophenoxy]phenyl] propanoate (PubChem CID 91558705) has the molecular formula C19H18Cl2N2O6 and a molecular weight of 441.27 g/mol. Its IUPAC name is [3,5-dichloro-4-[4-(2-methylpropanoylamino)-3-nitrophenoxy]phenyl] propanoate.
| Compound Name | [3,5-dichloro-4-[4-(2-methylpropanoylamino)-3-nitrophenoxy]phenyl] propanoate |
|---|---|
| PubChem CID | 91558705 |
| Molecular Formula | C19H18Cl2N2O6 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | [3,5-dichloro-4-[4-(2-methylpropanoylamino)-3-nitrophenoxy]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(Cl)c(Oc2ccc(NC(=O)C(C)C)c([N+](=O)[O-])c2)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N2O6/c1-4-17(24)28-12-7-13(20)18(14(21)8-12)29-11-5-6-15(16(9-11)23(26)27)22-19(25)10(2)3/h5-10H,4H2,1-3H3,(H,22,25) |
| InChIKey | IKKKPWSTLWTPDD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|