C18H17ClN2O7 — CID 8982646
[(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate (PubChem CID 8982646) has the molecular formula C18H17ClN2O7 and a molecular weight of 408.79 g/mol. Its IUPAC name is [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8982646 |
| Molecular Formula | C18H17ClN2O7 |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [(2S)-1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate |
| SMILES | COc1ccc(NC(=O)[C@H](C)OC(=O)COc2cccc(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17ClN2O7/c1-11(28-17(22)10-27-14-5-3-4-12(19)8-14)18(23)20-15-7-6-13(26-2)9-16(15)21(24)25/h3-9,11H,10H2,1-2H3,(H,20,23)/t11-/m0/s1 |
| InChIKey | DRABHCSHRJQIGY-NSHDSACASA-N |
| XLogP | 3.21 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|