C18H15Cl3N2O7 — CID 55417011
[1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 55417011) has the molecular formula C18H15Cl3N2O7 and a molecular weight of 477.68 g/mol. Its IUPAC name is [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 55417011 |
| Molecular Formula | C18H15Cl3N2O7 |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)COc2cc(Cl)c(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15Cl3N2O7/c1-9(18(25)22-14-4-3-10(28-2)5-15(14)23(26)27)30-17(24)8-29-16-7-12(20)11(19)6-13(16)21/h3-7,9H,8H2,1-2H3,(H,22,25) |
| InChIKey | NMEUYVREMABMIC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|