C22H24N2O7 — CID 46617921
[1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylphenyl)-4-oxobutanoate (PubChem CID 46617921) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylphenyl)-4-oxobutanoate.
| Compound Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 46617921 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylphenyl)-4-oxobutanoate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)CCC(=O)c2cc(C)ccc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N2O7/c1-13-5-6-14(2)17(11-13)20(25)9-10-21(26)31-15(3)22(27)23-18-8-7-16(30-4)12-19(18)24(28)29/h5-8,11-12,15H,9-10H2,1-4H3,(H,23,27) |
| InChIKey | HBMGDAZDODWYPZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|