C21H26N4O8 — CID 55444076
[1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate (PubChem CID 55444076) has the molecular formula C21H26N4O8 and a molecular weight of 462.46 g/mol. Its IUPAC name is [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate.
| Compound Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
|---|---|
| PubChem CID | 55444076 |
| Molecular Formula | C21H26N4O8 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [1-(4-methoxy-2-nitroanilino)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)CCN2C(=O)NC3(CCCCC3)C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N4O8/c1-13(18(27)22-15-7-6-14(32-2)12-16(15)25(30)31)33-17(26)8-11-24-19(28)21(23-20(24)29)9-4-3-5-10-21/h6-7,12-13H,3-5,8-11H2,1-2H3,(H,22,27)(H,23,29) |
| InChIKey | GIQQQWVHFUZPOT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|