C20H24N4O6 — CID 8965336
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate (PubChem CID 8965336) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate |
|---|---|
| PubChem CID | 8965336 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoate |
| SMILES | C[C@@H](OC(=O)CCN1C(=O)NC2(CCCC2)C1=O)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O6/c1-13(16(26)22-23-17(27)14-7-3-2-4-8-14)30-15(25)9-12-24-18(28)20(21-19(24)29)10-5-6-11-20/h2-4,7-8,13H,5-6,9-12H2,1H3,(H,21,29)(H,22,26)(H,23,27)/t13-/m1/s1 |
| InChIKey | ABAMKJLAZIBRGP-CYBMUJFWSA-N |
| XLogP | 0.63 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|