C22H30N4O5 — CID 27537627
[(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate (PubChem CID 27537627) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate.
| Compound Name | [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
|---|---|
| PubChem CID | 27537627 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [(2S)-1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
| SMILES | C[C@H](OC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H30N4O5/c1-15(19(28)23-16-8-10-17(11-9-16)25(2)3)31-18(27)7-6-14-26-20(29)22(24-21(26)30)12-4-5-13-22/h8-11,15H,4-7,12-14H2,1-3H3,(H,23,28)(H,24,30)/t15-/m0/s1 |
| InChIKey | PPVYGDHXZRJBNB-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|