C19H25N3O5 — CID 8703286
[(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 8703286) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 8703286 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | Cc1ccc(NC(=O)[C@H](C)OC(=O)CCCN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C19H25N3O5/c1-12-7-9-14(10-8-12)20-16(24)13(2)27-15(23)6-5-11-22-17(25)19(3,4)21-18(22)26/h7-10,13H,5-6,11H2,1-4H3,(H,20,24)(H,21,26)/t13-/m0/s1 |
| InChIKey | GYKVOFZFCMRVBU-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|