C24H32N4O6 — CID 25409091
[(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate (PubChem CID 25409091) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate.
| Compound Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
|---|---|
| PubChem CID | 25409091 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
| SMILES | C[C@@H](OC(=O)CCCN1C(=O)NC2(CCCC2)C1=O)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H32N4O6/c1-17(21(30)25-18-6-8-19(9-7-18)27-13-15-33-16-14-27)34-20(29)5-4-12-28-22(31)24(26-23(28)32)10-2-3-11-24/h6-9,17H,2-5,10-16H2,1H3,(H,25,30)(H,26,32)/t17-/m1/s1 |
| InChIKey | IRRZXBBPYKVVFY-QGZVFWFLSA-N |
| XLogP | 2.04 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|