C19H24ClN3O5 — CID 9310189
[(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 9310189) has the molecular formula C19H24ClN3O5 and a molecular weight of 409.87 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 9310189 |
| Molecular Formula | C19H24ClN3O5 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H](C)OC(=O)CCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C19H24ClN3O5/c1-11-7-8-13(20)10-14(11)21-16(25)12(2)28-15(24)6-5-9-23-17(26)19(3,4)22-18(23)27/h7-8,10,12H,5-6,9H2,1-4H3,(H,21,25)(H,22,27)/t12-/m1/s1 |
| InChIKey | DCMNGKMIIFCFSO-GFCCVEGCSA-N |
| XLogP | 2.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|