C24H32ClN3O5 — CID 46624173
[1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 46624173) has the molecular formula C24H32ClN3O5 and a molecular weight of 477.99 g/mol. Its IUPAC name is [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 46624173 |
| Molecular Formula | C24H32ClN3O5 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(C)OC(=O)CN1C(=O)NC2(CCC(C(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C24H32ClN3O5/c1-14-6-7-17(25)12-18(14)26-20(30)15(2)33-19(29)13-28-21(31)24(27-22(28)32)10-8-16(9-11-24)23(3,4)5/h6-7,12,15-16H,8-11,13H2,1-5H3,(H,26,30)(H,27,32) |
| InChIKey | NFBHMHFCRDMROC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|