C22H27Cl2N3O5 — CID 42975477
[1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 42975477) has the molecular formula C22H27Cl2N3O5 and a molecular weight of 484.38 g/mol. Its IUPAC name is [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 42975477 |
| Molecular Formula | C22H27Cl2N3O5 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)OC(C)C(=O)Nc1ccc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C22H27Cl2N3O5/c1-12-8-21(3,4)11-22(9-12)19(30)27(20(31)26-22)10-17(28)32-13(2)18(29)25-16-6-5-14(23)7-15(16)24/h5-7,12-13H,8-11H2,1-4H3,(H,25,29)(H,26,31) |
| InChIKey | SYVIJJOWZMHGMG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|