C20H23F2N3O5 — CID 47094481
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 47094481) has the molecular formula C20H23F2N3O5 and a molecular weight of 423.42 g/mol. Its IUPAC name is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 47094481 |
| Molecular Formula | C20H23F2N3O5 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)OC(C)C(=O)Nc1ccc(F)cc1F)C2=O |
| InChI | InChI=1S/C20H23F2N3O5/c1-11-5-7-20(8-6-11)18(28)25(19(29)24-20)10-16(26)30-12(2)17(27)23-15-4-3-13(21)9-14(15)22/h3-4,9,11-12H,5-8,10H2,1-2H3,(H,23,27)(H,24,29) |
| InChIKey | ZXHKSCMXBCOARE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|