C20H16F2N2O5 — CID 9310576
[(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate (PubChem CID 9310576) has the molecular formula C20H16F2N2O5 and a molecular weight of 402.35 g/mol. Its IUPAC name is [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate.
| Compound Name | [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 9310576 |
| Molecular Formula | C20H16F2N2O5 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)Cc2ccccc2C1=O)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H16F2N2O5/c1-11(19(27)23-16-7-6-13(21)9-15(16)22)29-18(26)10-24-17(25)8-12-4-2-3-5-14(12)20(24)28/h2-7,9,11H,8,10H2,1H3,(H,23,27)/t11-/m0/s1 |
| InChIKey | IROZYQRNOBEOJU-NSHDSACASA-N |
| XLogP | 2.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|