C22H22N2O6 — CID 9308337
[(2S)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate (PubChem CID 9308337) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is [(2S)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate.
| Compound Name | [(2S)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate |
|---|---|
| PubChem CID | 9308337 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [(2S)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate |
| SMILES | COc1ccc(NC(=O)[C@H](C)OC(=O)CCN2C(=O)Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H22N2O6/c1-14(21(27)23-16-7-9-17(29-2)10-8-16)30-20(26)11-12-24-19(25)13-15-5-3-4-6-18(15)22(24)28/h3-10,14H,11-13H2,1-2H3,(H,23,27)/t14-/m0/s1 |
| InChIKey | CWNUNIIXFYEILJ-AWEZNQCLSA-N |
| XLogP | 2.18 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|