C21H18F2N2O5 — CID 9308353
[(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate (PubChem CID 9308353) has the molecular formula C21H18F2N2O5 and a molecular weight of 416.38 g/mol. Its IUPAC name is [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate.
| Compound Name | [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate |
|---|---|
| PubChem CID | 9308353 |
| Molecular Formula | C21H18F2N2O5 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [(2R)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoate |
| SMILES | C[C@@H](OC(=O)CCN1C(=O)Cc2ccccc2C1=O)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H18F2N2O5/c1-12(20(28)24-17-7-6-14(22)11-16(17)23)30-19(27)8-9-25-18(26)10-13-4-2-3-5-15(13)21(25)29/h2-7,11-12H,8-10H2,1H3,(H,24,28)/t12-/m1/s1 |
| InChIKey | RJRLOAGQXFUFTK-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|