C19H16ClN3O5 — CID 9310574
[(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate (PubChem CID 9310574) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate.
| Compound Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 9310574 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [(2S)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)Cc2ccccc2C1=O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C19H16ClN3O5/c1-11(18(26)22-14-7-4-8-21-17(14)20)28-16(25)10-23-15(24)9-12-5-2-3-6-13(12)19(23)27/h2-8,11H,9-10H2,1H3,(H,22,26)/t11-/m0/s1 |
| InChIKey | XZLNUDURBHCUOW-NSHDSACASA-N |
| XLogP | 1.83 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|