C17H17F2N3O5 — CID 7822036
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7822036) has the molecular formula C17H17F2N3O5 and a molecular weight of 381.34 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7822036 |
| Molecular Formula | C17H17F2N3O5 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)NC2(CCCC2)C1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H17F2N3O5/c18-10-3-4-12(11(19)7-10)20-13(23)9-27-14(24)8-22-15(25)17(21-16(22)26)5-1-2-6-17/h3-4,7H,1-2,5-6,8-9H2,(H,20,23)(H,21,26) |
| InChIKey | QNSUZUPFDRIOCW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|