C19H21N3O7 — CID 7822094
methyl 4-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 7822094) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is methyl 4-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7822094 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | methyl 4-[[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H21N3O7/c1-28-16(25)12-4-6-13(7-5-12)20-14(23)11-29-15(24)10-22-17(26)19(21-18(22)27)8-2-3-9-19/h4-7H,2-3,8-11H2,1H3,(H,20,23)(H,21,27) |
| InChIKey | SUOYKFCMHXTDCF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|