C19H24N4O7S — CID 30965722
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 30965722) has the molecular formula C19H24N4O7S and a molecular weight of 452.49 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 30965722 |
| Molecular Formula | C19H24N4O7S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CN2C(=O)NC3(CCCCC3)C2=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H24N4O7S/c1-12-5-6-13(9-14(12)31(20,28)29)21-15(24)11-30-16(25)10-23-17(26)19(22-18(23)27)7-3-2-4-8-19/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,21,24)(H,22,27)(H2,20,28,29) |
| InChIKey | VSUPLNSXGNKIOR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|