C16H22N2O6S — CID 55569249
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate (PubChem CID 55569249) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55569249 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C2(O)CCCCC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H22N2O6S/c1-11-5-6-12(9-13(11)25(17,22)23)18-14(19)10-24-15(20)16(21)7-3-2-4-8-16/h5-6,9,21H,2-4,7-8,10H2,1H3,(H,18,19)(H2,17,22,23) |
| InChIKey | JSUVQIMRKAEEFW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |