C16H14Cl2N2O5S — CID 55367935
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 3,4-dichlorobenzoate (PubChem CID 55367935) has the molecular formula C16H14Cl2N2O5S and a molecular weight of 417.27 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 3,4-dichlorobenzoate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 55367935 |
| Molecular Formula | C16H14Cl2N2O5S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(Cl)c(Cl)c2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H14Cl2N2O5S/c1-9-2-4-11(7-14(9)26(19,23)24)20-15(21)8-25-16(22)10-3-5-12(17)13(18)6-10/h2-7H,8H2,1H3,(H,20,21)(H2,19,23,24) |
| InChIKey | IECRENRMVYVUEU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |