C19H19Cl2NO3 — CID 2535262
[2-(4-tert-butylanilino)-2-oxoethyl] 3,4-dichlorobenzoate (PubChem CID 2535262) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 3,4-dichlorobenzoate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2535262 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 3,4-dichlorobenzoate |
| SMILES | CC(C)(C)c1ccc(NC(=O)COC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-19(2,3)13-5-7-14(8-6-13)22-17(23)11-25-18(24)12-4-9-15(20)16(21)10-12/h4-10H,11H2,1-3H3,(H,22,23) |
| InChIKey | PSGRAEBFOXZSTP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |