C28H28Cl2N2O5S — CID 2416304
[2-(4-tert-butylanilino)-2-oxoethyl] 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 2416304) has the molecular formula C28H28Cl2N2O5S and a molecular weight of 575.51 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2416304 |
| Molecular Formula | C28H28Cl2N2O5S |
| Molecular Weight | 575.51 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1cc(C(=O)OCC(=O)Nc2ccc(C(C)(C)C)cc2)ccc1Cl |
| InChI | InChI=1S/C28H28Cl2N2O5S/c1-5-16-32(23-13-9-21(29)10-14-23)38(35,36)25-17-19(6-15-24(25)30)27(34)37-18-26(33)31-22-11-7-20(8-12-22)28(2,3)4/h5-15,17H,1,16,18H2,2-4H3,(H,31,33) |
| InChIKey | QVEOLOCFBMDYNF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|