C19H18ClNO5S — CID 42970176
2-oxopropyl 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 42970176) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is 2-oxopropyl 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | 2-oxopropyl 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 42970176 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-oxopropyl 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)OCC(C)=O)ccc1Cl |
| InChI | InChI=1S/C19H18ClNO5S/c1-3-11-21(16-7-5-4-6-8-16)27(24,25)18-12-15(9-10-17(18)20)19(23)26-13-14(2)22/h3-10,12H,1,11,13H2,2H3 |
| InChIKey | DJLPPLSSHFHYNY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|