C22H19ClN4O4S — CID 26533725
2-chloro-N-phenyl-N-prop-2-enyl-5-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 26533725) has the molecular formula C22H19ClN4O4S and a molecular weight of 470.94 g/mol. Its IUPAC name is 2-chloro-N-phenyl-N-prop-2-enyl-5-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-phenyl-N-prop-2-enyl-5-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26533725 |
| Molecular Formula | C22H19ClN4O4S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 2-chloro-N-phenyl-N-prop-2-enyl-5-[(pyridine-2-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)NNC(=O)c2ccccn2)ccc1Cl |
| InChI | InChI=1S/C22H19ClN4O4S/c1-2-14-27(17-8-4-3-5-9-17)32(30,31)20-15-16(11-12-18(20)23)21(28)25-26-22(29)19-10-6-7-13-24-19/h2-13,15H,1,14H2,(H,25,28)(H,26,29) |
| InChIKey | YRBPAAQOULGMOQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|