C23H20ClN3O4S — CID 26591753
5-(benzamidocarbamoyl)-2-chloro-N-phenyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 26591753) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is 5-(benzamidocarbamoyl)-2-chloro-N-phenyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 5-(benzamidocarbamoyl)-2-chloro-N-phenyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 26591753 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 5-(benzamidocarbamoyl)-2-chloro-N-phenyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)NNC(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C23H20ClN3O4S/c1-2-15-27(19-11-7-4-8-12-19)32(30,31)21-16-18(13-14-20(21)24)23(29)26-25-22(28)17-9-5-3-6-10-17/h2-14,16H,1,15H2,(H,25,28)(H,26,29) |
| InChIKey | LEPVBYAYSYPBSN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|