C23H28ClN3O4S — CID 55948031
N-[3-(butan-2-ylamino)-3-oxopropyl]-4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide (PubChem CID 55948031) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55948031 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)NCCC(=O)NC(C)CC)ccc1Cl |
| InChI | InChI=1S/C23H28ClN3O4S/c1-4-15-27(19-9-7-6-8-10-19)32(30,31)21-16-18(11-12-20(21)24)23(29)25-14-13-22(28)26-17(3)5-2/h4,6-12,16-17H,1,5,13-15H2,2-3H3,(H,25,29)(H,26,28) |
| InChIKey | ZZYIYBVIUYLCDF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|