C22H25Cl2N3O4S — CID 46655382
4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-[1-oxo-1-(propylamino)propan-2-yl]benzamide (PubChem CID 46655382) has the molecular formula C22H25Cl2N3O4S and a molecular weight of 498.43 g/mol. Its IUPAC name is 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-[1-oxo-1-(propylamino)propan-2-yl]benzamide.
| Compound Name | 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-[1-oxo-1-(propylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 46655382 |
| Molecular Formula | C22H25Cl2N3O4S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-[1-oxo-1-(propylamino)propan-2-yl]benzamide |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1cc(C(=O)NC(C)C(=O)NCCC)ccc1Cl |
| InChI | InChI=1S/C22H25Cl2N3O4S/c1-4-12-25-21(28)15(3)26-22(29)16-6-11-19(24)20(14-16)32(30,31)27(13-5-2)18-9-7-17(23)8-10-18/h5-11,14-15H,2,4,12-13H2,1,3H3,(H,25,28)(H,26,29) |
| InChIKey | SCUCKVKGPBZCRH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|