C13H18ClN3O4S — CID 8751734
4-chloro-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]-3-(methylsulfamoyl)benzamide (PubChem CID 8751734) has the molecular formula C13H18ClN3O4S and a molecular weight of 347.82 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]-3-(methylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 8751734 |
| Molecular Formula | C13H18ClN3O4S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-chloro-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]-3-(methylsulfamoyl)benzamide |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)c1ccc(Cl)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C13H18ClN3O4S/c1-4-16-12(18)8(2)17-13(19)9-5-6-10(14)11(7-9)22(20,21)15-3/h5-8,15H,4H2,1-3H3,(H,16,18)(H,17,19)/t8-/m1/s1 |
| InChIKey | UAMHCTTVBVTYLZ-MRVPVSSYSA-N |
| XLogP | 0.50 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |