C14H19ClN2O5S — CID 8884838
[(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 8884838) has the molecular formula C14H19ClN2O5S and a molecular weight of 362.84 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8884838 |
| Molecular Formula | C14H19ClN2O5S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CCCNC(=O)[C@H](C)OC(=O)c1ccc(Cl)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C14H19ClN2O5S/c1-4-7-17-13(18)9(2)22-14(19)10-5-6-11(15)12(8-10)23(20,21)16-3/h5-6,8-9,16H,4,7H2,1-3H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | AHQKLKDNBYYWHI-VIFPVBQESA-N |
| XLogP | 1.32 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |