C16H21ClN2O5S — CID 9062209
[(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate (PubChem CID 9062209) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9062209 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
| SMILES | CCCNC(=O)[C@@H](C)OC(=O)c1ccc(Cl)c(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C16H21ClN2O5S/c1-3-8-18-15(20)10(2)24-16(21)11-4-7-13(17)14(9-11)25(22,23)19-12-5-6-12/h4,7,9-10,12,19H,3,5-6,8H2,1-2H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | JTUNQNFJEKPWJZ-SNVBAGLBSA-N |
| XLogP | 1.85 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |