C17H15Cl2NO4S — CID 8672183
(2-chlorophenyl)methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate (PubChem CID 8672183) has the molecular formula C17H15Cl2NO4S and a molecular weight of 400.28 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | (2-chlorophenyl)methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8672183 |
| Molecular Formula | C17H15Cl2NO4S |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (2-chlorophenyl)methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
| SMILES | O=C(OCc1ccccc1Cl)c1ccc(Cl)c(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C17H15Cl2NO4S/c18-14-4-2-1-3-12(14)10-24-17(21)11-5-8-15(19)16(9-11)25(22,23)20-13-6-7-13/h1-5,8-9,13,20H,6-7,10H2 |
| InChIKey | WWTZJAFETNEBDO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |