C21H21N3O5S — CID 46819279
(3-methylquinoxalin-2-yl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 46819279) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is (3-methylquinoxalin-2-yl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | (3-methylquinoxalin-2-yl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 46819279 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (3-methylquinoxalin-2-yl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2nc3ccccc3nc2C)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C21H21N3O5S/c1-13-18(23-17-6-4-3-5-16(17)22-13)12-29-21(25)14-7-10-19(28-2)20(11-14)30(26,27)24-15-8-9-15/h3-7,10-11,15,24H,8-9,12H2,1-2H3 |
| InChIKey | NHOIZAXRSPYHNI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |