C15H19NO5S — CID 9380316
2-methylprop-2-enyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 9380316) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-methylprop-2-enyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | 2-methylprop-2-enyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 9380316 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-methylprop-2-enyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | C=C(C)COC(=O)c1ccc(OC)c(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H19NO5S/c1-10(2)9-21-15(17)11-4-7-13(20-3)14(8-11)22(18,19)16-12-5-6-12/h4,7-8,12,16H,1,5-6,9H2,2-3H3 |
| InChIKey | FLFQKCDMTYUUMJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|