C25H26N2O6S — CID 55404094
[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 55404094) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 55404094 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC(C)c2cccc3ccccc23)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C25H26N2O6S/c1-16(20-9-5-7-17-6-3-4-8-21(17)20)26-24(28)15-33-25(29)18-10-13-22(32-2)23(14-18)34(30,31)27-19-11-12-19/h3-10,13-14,16,19,27H,11-12,15H2,1-2H3,(H,26,28) |
| InChIKey | CVTZCOLTHZLOSI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |