C23H23NO5 — CID 9203454
[2-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 9203454) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 9203454 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [2-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)N[C@@H](C)c2cccc3ccccc23)c1OC |
| InChI | InChI=1S/C23H23NO5/c1-15(17-11-6-9-16-8-4-5-10-18(16)17)24-21(25)14-29-23(26)19-12-7-13-20(27-2)22(19)28-3/h4-13,15H,14H2,1-3H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | RJLWLOMTTVKBJU-HNNXBMFYSA-N |
| XLogP | 3.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |