C22H21ClN2O4 — CID 9343386
[2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 9343386) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 9343386 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H21ClN2O4/c1-13(15-9-5-7-14-6-3-4-8-16(14)15)25-21(26)12-29-22(27)17-10-18(23)19(24)11-20(17)28-2/h3-11,13H,12,24H2,1-2H3,(H,25,26)/t13-/m1/s1 |
| InChIKey | IUPUJILZXAVDGP-CYBMUJFWSA-N |
| XLogP | 4.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|