C21H17ClFNO3 — CID 9007241
[2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate (PubChem CID 9007241) has the molecular formula C21H17ClFNO3 and a molecular weight of 385.82 g/mol. Its IUPAC name is [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate.
| Compound Name | [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 9007241 |
| Molecular Formula | C21H17ClFNO3 |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [2-[[(1R)-1-naphthalen-1-ylethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1c(F)cccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H17ClFNO3/c1-13(15-9-4-7-14-6-2-3-8-16(14)15)24-19(25)12-27-21(26)20-17(22)10-5-11-18(20)23/h2-11,13H,12H2,1H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | PGUQEFYTHNAZTK-CYBMUJFWSA-N |
| XLogP | 4.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |