C19H19ClFNO3 — CID 7820326
[2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate (PubChem CID 7820326) has the molecular formula C19H19ClFNO3 and a molecular weight of 363.82 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate.
| Compound Name | [2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 7820326 |
| Molecular Formula | C19H19ClFNO3 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [2-[[(1S)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl] 2-chloro-6-fluorobenzoate |
| SMILES | CCc1ccc([C@H](C)NC(=O)COC(=O)c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClFNO3/c1-3-13-7-9-14(10-8-13)12(2)22-17(23)11-25-19(24)18-15(20)5-4-6-16(18)21/h4-10,12H,3,11H2,1-2H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | MURKEYOHYJSEQZ-LBPRGKRZSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |