C18H16Cl2FNO3 — CID 7718405
[2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718405) has the molecular formula C18H16Cl2FNO3 and a molecular weight of 384.23 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718405 |
| Molecular Formula | C18H16Cl2FNO3 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)Cc1c(F)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2FNO3/c1-11(12-5-7-13(19)8-6-12)22-17(23)10-25-18(24)9-14-15(20)3-2-4-16(14)21/h2-8,11H,9-10H2,1H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | QSSACDWMSJITFN-LLVKDONJSA-N |
| XLogP | 4.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |