C18H17BrClNO3 — CID 8578991
[2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate (PubChem CID 8578991) has the molecular formula C18H17BrClNO3 and a molecular weight of 410.70 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate.
| Compound Name | [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8578991 |
| Molecular Formula | C18H17BrClNO3 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | [2-[[(1R)-1-(4-bromophenyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)Cc1ccc(Cl)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrClNO3/c1-12(14-4-6-15(19)7-5-14)21-17(22)11-24-18(23)10-13-2-8-16(20)9-3-13/h2-9,12H,10-11H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | JINDBZQABYOVCJ-GFCCVEGCSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |